![[ICO]](/icons/blank.gif){kind=icon}
![[DIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[ ]](/icons/compressed.gif){kind=icon}
![[VID]](/icons/movie.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 32.jpg | 23-Jul-2006 23:02 | 17K | |
| Eco, Umberto - The Name Of The Rose.pdf | 10-Sep-2011 01:15 | 3.4M | |
| The Structure OF Scientific Revolutions 3rd ed - Thomas Kuhn.pdf | 18-Jun-2011 11:15 | 27M | |
| albert_nobel.pdf | 26-Nov-2009 20:59 | 295K | |
| cypa/ | 12-Apr-2012 16:43 | - | |
| francesca2.mp3 | 27-Aug-2009 22:41 | 38M | |
| ft.jpg | 11-Jan-2010 10:12 | 68K | |
| handel.mp3 | 29-Sep-2009 18:45 | 2.6M | |
| koosh.jpg | 09-Sep-2009 11:57 | 116K | |
| liberalgene.pdf | 29-Oct-2010 13:23 | 134K | |
| modart.zip | 14-Nov-2008 02:39 | 1.0M | |
| music/ | 12-Apr-2012 16:43 | - | |
| nqualsfull.wmv | 14-Nov-2008 02:46 | 172M | |
| partita2_guitar.mp3 | 25-Dec-2009 13:57 | 39M | |
| pdfbooks/ | 25-Sep-2011 12:14 | - | |
| ra.zip | 21-Mar-2009 16:56 | 1.5M | |
| ros.zip | 02-Dec-2011 09:21 | 53M | |
| smh/ | 02-Dec-2009 22:45 | - | |
| tchaikovsky.jpg | 16-Feb-2010 23:28 | 90K | |
| wtf.mp3 | 03-Mar-2010 22:36 | 3.4M | |